CAS 2043361-62-0 appears in our catalog under these names: Berberine Impurity 2, Berberine Impurity 7. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-12-ol chloride (CAS 2043361-62-0) is a chemical compound with the molecular formula C20H18ClNO5 and a molecular weight of 387.8 g/mol. IUPAC name: 16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-12-ol chloride. InChIKey: XXEHHDAMELICSI-UHFFFAOYSA-M.
| Molecular formula | C20H18ClNO5 |
|---|---|
| Molecular weight | 387.8 g/mol |
| IUPAC name | 16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-12-ol chloride |
| InChIKey | XXEHHDAMELICSI-UHFFFAOYSA-M |
| SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3O)OCO5)OC.[Cl-] |
Computed by PubChem (NCBI)