CAS 2692652-36-9 is the registry number for Anticancer agent 68. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
Methyl 4-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]methoxy]-2-hydroxy-3,6-dimethylbenzoate (CAS 2692652-36-9) is a chemical compound with the molecular formula C20H18ClNO5 and a molecular weight of 387.8 g/mol. IUPAC name: methyl 4-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]methoxy]-2-hydroxy-3,6-dimethylbenzoate. InChIKey: ATDMPOZXJJPGHM-UHFFFAOYSA-N.
| Molecular formula | C20H18ClNO5 |
|---|---|
| Molecular weight | 387.8 g/mol |
| IUPAC name | methyl 4-[[3-(4-chlorophenyl)-1,2-oxazol-5-yl]methoxy]-2-hydroxy-3,6-dimethylbenzoate |
| InChIKey | ATDMPOZXJJPGHM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C(=O)OC)O)C)OCC2=CC(=NO2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)