CAS 204376-48-7 appears in our catalog under these names: Boc-Amcp-OH, 98%, Boc-AMCP-OH, 1-(((tert-Butoxycarbonyl)amino)methyl)cyclopropane-1-carboxylic acid 97%, Boc-Amcp-OH, 97%. Offered by: Combi-blocks, Creative Peptides, Iris Biotech, Ambeed, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 25g, 1g, 100mg.
1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclopropane-1-carboxylic acid (CAS 204376-48-7) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: 1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclopropane-1-carboxylic acid. InChIKey: UGPTVCJIZPFGLU-UHFFFAOYSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclopropane-1-carboxylic acid |
| InChIKey | UGPTVCJIZPFGLU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1(CC1)C(=O)O |
Computed by PubChem (NCBI)