Products 2043778-87-4
CAS 2043778-87-4 appears in our catalog under these names: N–Methylpiperazine–d3 hydrochloride, N-Methylpiperazine-d3 (hydrochloride), 97.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, 100 mg, 10 mg, 50 mg, 25 mg.
1-(trideuteriomethyl)piperazine;dihydrochloride (CAS 2043778-87-4) is a chemical compound with the molecular formula C5H14Cl2N2 and a molecular weight of 176.10 g/mol. IUPAC name: 1-(trideuteriomethyl)piperazine;dihydrochloride. InChIKey: AILFRWRYZZVJTL-GXXYEPOPSA-N.
| Molecular formula | C5H14Cl2N2 |
|---|---|
| Molecular weight | 176.10 g/mol |
| IUPAC name | 1-(trideuteriomethyl)piperazine;dihydrochloride |
| InChIKey | AILFRWRYZZVJTL-GXXYEPOPSA-N |
| SMILES | [2H]C([2H])([2H])N1CCNCC1.Cl.Cl |
Computed by PubChem (NCBI)