Products 3029270-07-0
CAS 3029270-07-0 appears in our catalog under these names: 1-Methylpiperazine-2,2,3,3,5,5,6,6-d8 dihydrochloride, 95%, N-Methylpiperazine-d8 (hydrochloride), 99.0%. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 5 mg, 10 mg.
2,2,3,3,5,5,6,6-octadeuterio-1-methylpiperazine;dihydrochloride (CAS 3029270-07-0) is a chemical compound with the molecular formula C5H14Cl2N2 and a molecular weight of 181.13 g/mol. IUPAC name: 2,2,3,3,5,5,6,6-octadeuterio-1-methylpiperazine;dihydrochloride. InChIKey: AILFRWRYZZVJTL-LLYWXKFCSA-N.
| Molecular formula | C5H14Cl2N2 |
|---|---|
| Molecular weight | 181.13 g/mol |
| IUPAC name | 2,2,3,3,5,5,6,6-octadeuterio-1-methylpiperazine;dihydrochloride |
| InChIKey | AILFRWRYZZVJTL-LLYWXKFCSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C)([2H])[2H])[2H].Cl.Cl |
Computed by PubChem (NCBI)