Products 204378-34-7

CAS 204378-34-7 is the registry number for 4-Chloro-6-methoxypicolinic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-chloro-6-methoxypyridine-2-carboxylic acid (CAS 204378-34-7) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 4-chloro-6-methoxypyridine-2-carboxylic acid. InChIKey: CIOQPFUXWMRYQW-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6ClNO3
Molecular weight187.58 g/mol
IUPAC name4-chloro-6-methoxypyridine-2-carboxylic acid
InChIKeyCIOQPFUXWMRYQW-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=N1)C(=O)O)Cl

Computed by PubChem (NCBI)