Products 2044268-98-4

CAS 2044268-98-4 is the registry number for Ethyl 1-amino-1H-imidazole-2-carboxylate dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 1-aminoimidazole-2-carboxylate;dihydrochloride (CAS 2044268-98-4) is a chemical compound with the molecular formula C6H11Cl2N3O2 and a molecular weight of 228.07 g/mol. IUPAC name: ethyl 1-aminoimidazole-2-carboxylate;dihydrochloride. InChIKey: JUYICPOAEZAWSZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11Cl2N3O2
Molecular weight228.07 g/mol
IUPAC nameethyl 1-aminoimidazole-2-carboxylate;dihydrochloride
InChIKeyJUYICPOAEZAWSZ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NC=CN1N.Cl.Cl

Computed by PubChem (NCBI)