CAS 2825007-63-2 is the registry number for Methyl 2-(aminomethyl)-1H-imidazole-5-carboxylate dihydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 2-(aminomethyl)-1H-imidazole-5-carboxylate;dihydrochloride (CAS 2825007-63-2) is a chemical compound with the molecular formula C6H11Cl2N3O2 and a molecular weight of 228.07 g/mol. IUPAC name: methyl 2-(aminomethyl)-1H-imidazole-5-carboxylate;dihydrochloride. InChIKey: HTLILJYNWYZRPN-UHFFFAOYSA-N.
| Molecular formula | C6H11Cl2N3O2 |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | methyl 2-(aminomethyl)-1H-imidazole-5-carboxylate;dihydrochloride |
| InChIKey | HTLILJYNWYZRPN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(N1)CN.Cl.Cl |
Computed by PubChem (NCBI)