CAS 20443-91-8 is the registry number for 2-(4-nitrophenoxy)oxane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4-nitrophenoxy)oxane (CAS 20443-91-8) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 2-(4-nitrophenoxy)oxane. InChIKey: FCIBEQMWPFEHGQ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 2-(4-nitrophenoxy)oxane |
| InChIKey | FCIBEQMWPFEHGQ-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)