Products 2044712-54-9
CAS 2044712-54-9 is the registry number for 3-Amino-1-(4-(trifluoromethyl)phenyl)pyrrolidin-2-one hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-amino-1-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one;hydrochloride (CAS 2044712-54-9) is a chemical compound with the molecular formula C11H12ClF3N2O and a molecular weight of 280.67 g/mol. IUPAC name: 3-amino-1-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one;hydrochloride. InChIKey: UCCNPBCBOWYLJG-UHFFFAOYSA-N.
| Molecular formula | C11H12ClF3N2O |
|---|---|
| Molecular weight | 280.67 g/mol |
| IUPAC name | 3-amino-1-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one;hydrochloride |
| InChIKey | UCCNPBCBOWYLJG-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)C1N)C2=CC=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)