Products 2044773-25-1

CAS 2044773-25-1 is the registry number for 4-(TERT-BUTOXY)CYCLOHEXAN-1-AMINE HYDROCHLORIDE, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

4-[(2-methylpropan-2-yl)oxy]cyclohexan-1-amine;hydrochloride (CAS 2044773-25-1) is a chemical compound with the molecular formula C10H22ClNO and a molecular weight of 207.74 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxy]cyclohexan-1-amine;hydrochloride. InChIKey: VZGZZKFRYJESPW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H22ClNO
Molecular weight207.74 g/mol
IUPAC name4-[(2-methylpropan-2-yl)oxy]cyclohexan-1-amine;hydrochloride
InChIKeyVZGZZKFRYJESPW-UHFFFAOYSA-N
SMILESCC(C)(C)OC1CCC(CC1)N.Cl

Computed by PubChem (NCBI)