Products 2044901-38-2

CAS 2044901-38-2 is the registry number for tert-Butyl 1,2,3,6-tetrahydropyridazine-1-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 3,6-dihydro-1H-pyridazine-2-carboxylate;hydrochloride (CAS 2044901-38-2) is a chemical compound with the molecular formula C9H17ClN2O2 and a molecular weight of 220.69 g/mol. IUPAC name: tert-butyl 3,6-dihydro-1H-pyridazine-2-carboxylate;hydrochloride. InChIKey: JGPOCXMDVPXCDS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17ClN2O2
Molecular weight220.69 g/mol
IUPAC nametert-butyl 3,6-dihydro-1H-pyridazine-2-carboxylate;hydrochloride
InChIKeyJGPOCXMDVPXCDS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC=CCN1.Cl

Computed by PubChem (NCBI)