CAS 2044901-56-4 is the registry number for 6-(Pyrrolidin-2-yl)pyridazin-3-ol hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
3-pyrrolidin-2-yl-1H-pyridazin-6-one;hydrochloride (CAS 2044901-56-4) is a chemical compound with the molecular formula C8H12ClN3O and a molecular weight of 201.65 g/mol. IUPAC name: 3-pyrrolidin-2-yl-1H-pyridazin-6-one;hydrochloride. InChIKey: UESFKGSNGRSBEU-UHFFFAOYSA-N.
| Molecular formula | C8H12ClN3O |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 3-pyrrolidin-2-yl-1H-pyridazin-6-one;hydrochloride |
| InChIKey | UESFKGSNGRSBEU-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=NNC(=O)C=C2.Cl |
Computed by PubChem (NCBI)