CAS 2044902-57-8 appears in our catalog under these names: 3,4-Dihydrospiro(1-benzopyran-2,1'-cyclobutane)-6-amine, 95%, 3,4-Dihydrospiro(1-benzopyran-2,1'-cyclobutane)-6-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Spiro[3,4-dihydrochromene-2,1'-cyclobutane]-6-amine (CAS 2044902-57-8) is a chemical compound with the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. IUPAC name: spiro[3,4-dihydrochromene-2,1'-cyclobutane]-6-amine. InChIKey: BAYNEJNAFLQDSR-UHFFFAOYSA-N.
| Molecular formula | C12H15NO |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | spiro[3,4-dihydrochromene-2,1'-cyclobutane]-6-amine |
| InChIKey | BAYNEJNAFLQDSR-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CCC3=C(O2)C=CC(=C3)N |
Computed by PubChem (NCBI)