CAS 204513-55-3 appears in our catalog under these names: 4-Bromo-2-({[tert-butyl(dimethyl)silyl]oxy}methyl)-1,3-thiazole, 98%, 98%, 4-bromo-2-(((tert-butyldimethylsilyl)oxy)methyl)thiazole, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(4-bromo-1,3-thiazol-2-yl)methoxy-tert-butyl-dimethylsilane (CAS 204513-55-3) is a chemical compound with the molecular formula C10H18BrNOSSi and a molecular weight of 308.31 g/mol. IUPAC name: (4-bromo-1,3-thiazol-2-yl)methoxy-tert-butyl-dimethylsilane. InChIKey: ABNDUXPZLNEZHZ-UHFFFAOYSA-N.
| Molecular formula | C10H18BrNOSSi |
|---|---|
| Molecular weight | 308.31 g/mol |
| IUPAC name | (4-bromo-1,3-thiazol-2-yl)methoxy-tert-butyl-dimethylsilane |
| InChIKey | ABNDUXPZLNEZHZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=NC(=CS1)Br |
Computed by PubChem (NCBI)