CAS 936691-31-5 is the registry number for 2-Bromo-4-(((tert-butyldimethylsilyl)oxy)methyl)thiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2-bromo-1,3-thiazol-4-yl)methoxy-tert-butyl-dimethylsilane (CAS 936691-31-5) is a chemical compound with the molecular formula C10H18BrNOSSi and a molecular weight of 308.31 g/mol. IUPAC name: (2-bromo-1,3-thiazol-4-yl)methoxy-tert-butyl-dimethylsilane. InChIKey: WQLGUHSUNQOJSS-UHFFFAOYSA-N.
| Molecular formula | C10H18BrNOSSi |
|---|---|
| Molecular weight | 308.31 g/mol |
| IUPAC name | (2-bromo-1,3-thiazol-4-yl)methoxy-tert-butyl-dimethylsilane |
| InChIKey | WQLGUHSUNQOJSS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CSC(=N1)Br |
Computed by PubChem (NCBI)