Products 204782-96-7
CAS 204782-96-7 appears in our catalog under these names: 8-Bromo-5-quinolinecarboxylic acid, 95%, 8-Bromo-5-quinoline-5-carboxylic acid, 98%, 8-Bromoquinoline-5-carboxylic acid, 97%, 8-Bromoquinoline-5-carboxylic acid, 98%. Offered by: Combi-blocks, Fluorochem, Ambeed, BLDpharm, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 25g, 100mg.
8-bromoquinoline-5-carboxylic acid (CAS 204782-96-7) is a chemical compound with the molecular formula C10H6BrNO2 and a molecular weight of 252.06 g/mol. IUPAC name: 8-bromoquinoline-5-carboxylic acid. InChIKey: PPJDILQBGRMTFE-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2 |
|---|---|
| Molecular weight | 252.06 g/mol |
| IUPAC name | 8-bromoquinoline-5-carboxylic acid |
| InChIKey | PPJDILQBGRMTFE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)Br)C(=O)O |
Computed by PubChem (NCBI)