Products 204838-24-4
CAS 204838-24-4 is the registry number for Hydroxy Glyburide. Offered by: TRC. Available pack sizes: 250mg.
5-chloro-N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]-2-hydroxyethyl]-2-methoxybenzamide (CAS 204838-24-4) is a chemical compound with the molecular formula C23H28ClN3O6S and a molecular weight of 510.0 g/mol. IUPAC name: 5-chloro-N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]-2-hydroxyethyl]-2-methoxybenzamide. InChIKey: DEGYYEULZFVKCB-UHFFFAOYSA-N.
| Molecular formula | C23H28ClN3O6S |
|---|---|
| Molecular weight | 510.0 g/mol |
| IUPAC name | 5-chloro-N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]-2-hydroxyethyl]-2-methoxybenzamide |
| InChIKey | DEGYYEULZFVKCB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)C(=O)NCC(C2=CC=C(C=C2)S(=O)(=O)NC(=O)NC3CCCCC3)O |
Computed by PubChem (NCBI)
Synonyms:
Hydroxy Glyburide