CAS 23074-02-4 appears in our catalog under these names: rac-cis-3-Hydroxy Glyburide, rac cis-3-Hydroxy Glyburide, >95% (HPLC), 3-cis-Hydroxyglibenclamide. Offered by: Chemat Brand, TRC, Chemat, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 10 mg, 1 mg.
5-chloro-N-[2-[4-[[(1R,3S)-3-hydroxycyclohexyl]carbamoylsulfamoyl]phenyl]ethyl]-2-methoxybenzamide (CAS 23074-02-4) is a chemical compound with the molecular formula C23H28ClN3O6S and a molecular weight of 510.0 g/mol. IUPAC name: 5-chloro-N-[2-[4-[[(1R,3S)-3-hydroxycyclohexyl]carbamoylsulfamoyl]phenyl]ethyl]-2-methoxybenzamide. InChIKey: VFBAJFAMXTVSQA-MSOLQXFVSA-N.
| Molecular formula | C23H28ClN3O6S |
|---|---|
| Molecular weight | 510.0 g/mol |
| IUPAC name | 5-chloro-N-[2-[4-[[(1R,3S)-3-hydroxycyclohexyl]carbamoylsulfamoyl]phenyl]ethyl]-2-methoxybenzamide |
| InChIKey | VFBAJFAMXTVSQA-MSOLQXFVSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)C(=O)NCCC2=CC=C(C=C2)S(=O)(=O)NC(=O)N[C@@H]3CCC[C@@H](C3)O |
Computed by PubChem (NCBI)