CAS 38231-86-6 appears in our catalog under these names: (+) Valienamine, Valienamine HCl, (1S,2S,3R,6S)-6-Amino-4-(hydroxymethyl)-4-cyclohexene-1,2,3-triol, 98%, 98%, Valienamine. Offered by: Chemat Brand, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 1000ug, 500ug, 2000ug, 10000ug, 5000ug, 1mg, Get quote.
(1S,2S,3R,6S)-6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol (CAS 38231-86-6) is a chemical compound with the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. IUPAC name: (1S,2S,3R,6S)-6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol. InChIKey: XPHOBMULWMGEBA-VZFHVOOUSA-N.
| Molecular formula | C7H13NO4 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | (1S,2S,3R,6S)-6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol |
| InChIKey | XPHOBMULWMGEBA-VZFHVOOUSA-N |
| SMILES | C1=C([C@H]([C@@H]([C@H]([C@H]1N)O)O)O)CO |
Computed by PubChem (NCBI)