CAS 204981-49-7 is the registry number for 2,2-Dimethylpropyl-4'-(trifluoromethyl)benzoate-2'-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
[2-(2,2-dimethylpropoxycarbonyl)-5-(trifluoromethyl)phenyl]boronic acid (CAS 204981-49-7) is a chemical compound with the molecular formula C13H16BF3O4 and a molecular weight of 304.07 g/mol. IUPAC name: [2-(2,2-dimethylpropoxycarbonyl)-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: FKFFRSYPSCAHAE-UHFFFAOYSA-N.
| Molecular formula | C13H16BF3O4 |
|---|---|
| Molecular weight | 304.07 g/mol |
| IUPAC name | [2-(2,2-dimethylpropoxycarbonyl)-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | FKFFRSYPSCAHAE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(F)(F)F)C(=O)OCC(C)(C)C)(O)O |
Computed by PubChem (NCBI)