CAS 2377606-48-7 is the registry number for 3-(Tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)phenol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)phenol (CAS 2377606-48-7) is a chemical compound with the molecular formula C13H16BF3O4 and a molecular weight of 304.07 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)phenol. InChIKey: VHQGCCASYKIKNC-UHFFFAOYSA-N.
| Molecular formula | C13H16BF3O4 |
|---|---|
| Molecular weight | 304.07 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)phenol |
| InChIKey | VHQGCCASYKIKNC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OC(F)(F)F)O |
Computed by PubChem (NCBI)