CAS 2050-14-8 appears in our catalog under these names: 2,2'-Dihydroxyazobenzene, 95%, 2,2'–(Diazene–1,2–diyl)diphenol, 2,2'-Dihydroxyazobenzene [Spectrophotometric and fluorimetric reagent for Al, Mg and other metals], >98.0%(HPLC)(T), 2,2'-DIHYDROXYAZOBENZENE, 97%, 2,2'-Dihydroxyazobenzene, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg, 25g.
2-[(2-hydroxyphenyl)diazenyl]phenol (CAS 2050-14-8) is a chemical compound with the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. IUPAC name: 2-[(2-hydroxyphenyl)diazenyl]phenol. InChIKey: JFEVWPNAOCPRHQ-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 2-[(2-hydroxyphenyl)diazenyl]phenol |
| InChIKey | JFEVWPNAOCPRHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N=NC2=CC=CC=C2O)O |
Computed by PubChem (NCBI)