CAS 2050-15-9 appears in our catalog under these names: 3,3'-(Diazene-1,2-diyl)diphenol, 98%, 3,3'–(Diazene–1,2–diyl)diphenol, 3,3′-(1,2-Diazenediyl)bis[phenol], 98%, 98%. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
3-[(3-hydroxyphenyl)diazenyl]phenol (CAS 2050-15-9) is a chemical compound with the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. IUPAC name: 3-[(3-hydroxyphenyl)diazenyl]phenol. InChIKey: KONUTRXTUUBGKS-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 3-[(3-hydroxyphenyl)diazenyl]phenol |
| InChIKey | KONUTRXTUUBGKS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)N=NC2=CC(=CC=C2)O |
Computed by PubChem (NCBI)