CAS 2050-72-8 is the registry number for 1,6-Dichloronaphthalene. Offered by: TRC. Available pack sizes: 100mg, 10mg.
1,6-dichloronaphthalene (CAS 2050-72-8) is a chemical compound with the molecular formula C10H6Cl2 and a molecular weight of 197.06 g/mol. IUPAC name: 1,6-dichloronaphthalene. InChIKey: CEDZMDSZTVUPSP-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2 |
|---|---|
| Molecular weight | 197.06 g/mol |
| IUPAC name | 1,6-dichloronaphthalene |
| InChIKey | CEDZMDSZTVUPSP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Cl)C(=C1)Cl |
Computed by PubChem (NCBI)