CAS 2198-77-8 appears in our catalog under these names: 2,7-Dichloronaphthalene, 95%, 2,7-Dichloronaphthalene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg, 2000mg.
2,7-dichloronaphthalene (CAS 2198-77-8) is a chemical compound with the molecular formula C10H6Cl2 and a molecular weight of 197.06 g/mol. IUPAC name: 2,7-dichloronaphthalene. InChIKey: DWBQZSYTSNYEEJ-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2 |
|---|---|
| Molecular weight | 197.06 g/mol |
| IUPAC name | 2,7-dichloronaphthalene |
| InChIKey | DWBQZSYTSNYEEJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)