CAS 20511-20-0 appears in our catalog under these names: Ethyl 4-methylcinnamate, 95%, Ethyl 4-methylcinnamate, Ethyl 3-(p-tolyl)acrylate, 97% (E), 97% (E), Ethyl 3-(p-tolyl)acrylate, 97% (E). Offered by: Combi-blocks, Biosynth, Chemat, Ambeed. Available pack sizes: 5g, 1g, 250mg, 2,5g, 0,25g, 10g, 25g, 100g.
Ethyl 3-(4-methylphenyl)prop-2-enoate (CAS 20511-20-0) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: ethyl 3-(4-methylphenyl)prop-2-enoate. InChIKey: IMKVSWPEZCELRM-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | ethyl 3-(4-methylphenyl)prop-2-enoate |
| InChIKey | IMKVSWPEZCELRM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=CC1=CC=C(C=C1)C |
Computed by PubChem (NCBI)