Products 205114-14-3
CAS 205114-14-3 appears in our catalog under these names: 3-Bromoquinoline-6-carboxylic acid, 3-Bromoquinoline-6-carboxylic acid 95%, 3-BROMOQUINOLINE-6-CARBOXYLIC ACID, 98%, 3-Bromo-6-quinolinecarboxylic acid, 98%, 98%. Offered by: Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 25g, 10g.
3-bromoquinoline-6-carboxylic acid (CAS 205114-14-3) is a chemical compound with the molecular formula C10H6BrNO2 and a molecular weight of 252.06 g/mol. IUPAC name: 3-bromoquinoline-6-carboxylic acid. InChIKey: DKBPYVBSEJLPIR-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2 |
|---|---|
| Molecular weight | 252.06 g/mol |
| IUPAC name | 3-bromoquinoline-6-carboxylic acid |
| InChIKey | DKBPYVBSEJLPIR-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C=C2C=C1C(=O)O)Br |
Computed by PubChem (NCBI)