CAS 205117-47-1 appears in our catalog under these names: Bifendate Impurity E, Bicyclol Impurity D, 7,7'-Dimethoxy-(4,4'-Bi-1,3-benzodioxole)-5,5'-dicarboxylic Acid Monomethyl Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
7-methoxy-4-(7-methoxy-5-methoxycarbonyl-1,3-benzodioxol-4-yl)-1,3-benzodioxole-5-carboxylic acid (CAS 205117-47-1) is a chemical compound with the molecular formula C19H16O10 and a molecular weight of 404.3 g/mol. IUPAC name: 7-methoxy-4-(7-methoxy-5-methoxycarbonyl-1,3-benzodioxol-4-yl)-1,3-benzodioxole-5-carboxylic acid. InChIKey: VVRXOUGWCMBBIS-UHFFFAOYSA-N.
| Molecular formula | C19H16O10 |
|---|---|
| Molecular weight | 404.3 g/mol |
| IUPAC name | 7-methoxy-4-(7-methoxy-5-methoxycarbonyl-1,3-benzodioxol-4-yl)-1,3-benzodioxole-5-carboxylic acid |
| InChIKey | VVRXOUGWCMBBIS-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C(=C1)C(=O)O)C3=C4C(=C(C=C3C(=O)OC)OC)OCO4)OCO2 |
Computed by PubChem (NCBI)