CAS 433216-78-5 appears in our catalog under these names: 5,5'-(Propane-1,3-diylbis(oxy))diisophthalic acid, 95%, 5,5'-(Propane-1,3-diylbis(oxy))diisophthalic acid, 95%, 95%, 5,5'-(Propane-1,3-diylbis(oxy))diisophthalic acid, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
5-[3-(3,5-dicarboxyphenoxy)propoxy]benzene-1,3-dicarboxylic acid (CAS 433216-78-5) is a chemical compound with the molecular formula C19H16O10 and a molecular weight of 404.3 g/mol. IUPAC name: 5-[3-(3,5-dicarboxyphenoxy)propoxy]benzene-1,3-dicarboxylic acid. InChIKey: VRXRIAOVOVOHMX-UHFFFAOYSA-N.
| Molecular formula | C19H16O10 |
|---|---|
| Molecular weight | 404.3 g/mol |
| IUPAC name | 5-[3-(3,5-dicarboxyphenoxy)propoxy]benzene-1,3-dicarboxylic acid |
| InChIKey | VRXRIAOVOVOHMX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)OCCCOC2=CC(=CC(=C2)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)