Products 205128-76-3
CAS 205128-76-3 is the registry number for Fmoc-L-Phe(4-CH2OH)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(hydroxymethyl)phenyl]propanoic acid (CAS 205128-76-3) is a chemical compound with the molecular formula C25H23NO5 and a molecular weight of 417.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(hydroxymethyl)phenyl]propanoic acid. InChIKey: FXOZFJQSHVZWCN-QHCPKHFHSA-N.
| Molecular formula | C25H23NO5 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(hydroxymethyl)phenyl]propanoic acid |
| InChIKey | FXOZFJQSHVZWCN-QHCPKHFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=C(C=C4)CO)C(=O)O |
Computed by PubChem (NCBI)