Products 205171-11-5
CAS 205171-11-5 is the registry number for 2-Chloro-2′-β-C-methyladenosine, 99.91%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg.
(2R,3R,4R,5R)-2-(6-amino-2-chloropurin-9-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol (CAS 205171-11-5) is a chemical compound with the molecular formula C11H14ClN5O4 and a molecular weight of 315.71 g/mol. IUPAC name: (2R,3R,4R,5R)-2-(6-amino-2-chloropurin-9-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol. InChIKey: CKNNSJGYKWRNEN-GITKWUPZSA-N.
| Molecular formula | C11H14ClN5O4 |
|---|---|
| Molecular weight | 315.71 g/mol |
| IUPAC name | (2R,3R,4R,5R)-2-(6-amino-2-chloropurin-9-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
| InChIKey | CKNNSJGYKWRNEN-GITKWUPZSA-N |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1N2C=NC3=C(N=C(N=C32)Cl)N)CO)O)O |
Computed by PubChem (NCBI)