Products 634207-55-9
CAS 634207-55-9 is the registry number for 8-Chloro-2’-O-methyl adenosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R,4R,5R)-5-(6-amino-8-chloropurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-ol (CAS 634207-55-9) is a chemical compound with the molecular formula C11H14ClN5O4 and a molecular weight of 315.71 g/mol. IUPAC name: (2R,3R,4R,5R)-5-(6-amino-8-chloropurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-ol. InChIKey: IXTQMSFHXDXWKT-KQYNXXCUSA-N.
| Molecular formula | C11H14ClN5O4 |
|---|---|
| Molecular weight | 315.71 g/mol |
| IUPAC name | (2R,3R,4R,5R)-5-(6-amino-8-chloropurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-ol |
| InChIKey | IXTQMSFHXDXWKT-KQYNXXCUSA-N |
| SMILES | CO[C@@H]1[C@@H]([C@H](O[C@H]1N2C3=NC=NC(=C3N=C2Cl)N)CO)O |
Computed by PubChem (NCBI)