Products 2052297-80-8
CAS 2052297-80-8 is the registry number for Brivaracetam Impurity T. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-[(4R)-2-oxo-4-propylpyrrolidin-1-yl]butanoate (CAS 2052297-80-8) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: methyl (2S)-2-[(4R)-2-oxo-4-propylpyrrolidin-1-yl]butanoate. InChIKey: LOPBUDFWZJEGTJ-ZJUUUORDSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | methyl (2S)-2-[(4R)-2-oxo-4-propylpyrrolidin-1-yl]butanoate |
| InChIKey | LOPBUDFWZJEGTJ-ZJUUUORDSA-N |
| SMILES | CCC[C@@H]1CC(=O)N(C1)[C@@H](CC)C(=O)OC |
Computed by PubChem (NCBI)