CAS 20535-58-4 is the registry number for 5-(3,4-Dichlorophenyl)-6-(ethoxymethyl)pyrimidine-2,4-diamine. Offered by: TRC. Available pack sizes: 250mg.
5-(3,4-dichlorophenyl)-6-(ethoxymethyl)pyrimidine-2,4-diamine (CAS 20535-58-4) is a chemical compound with the molecular formula C13H14Cl2N4O and a molecular weight of 313.18 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)-6-(ethoxymethyl)pyrimidine-2,4-diamine. InChIKey: PDPRXKKYKMWYNG-UHFFFAOYSA-N.
| Molecular formula | C13H14Cl2N4O |
|---|---|
| Molecular weight | 313.18 g/mol |
| IUPAC name | 5-(3,4-dichlorophenyl)-6-(ethoxymethyl)pyrimidine-2,4-diamine |
| InChIKey | PDPRXKKYKMWYNG-UHFFFAOYSA-N |
| SMILES | CCOCC1=C(C(=NC(=N1)N)N)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)