CAS 848837-33-2 is the registry number for VUF 10214. Offered by: MedChemExpress. Available pack sizes: Get quote.
6,7-dichloro-3-(4-methylpiperazin-1-yl)-1H-quinoxalin-2-one (CAS 848837-33-2) is a chemical compound with the molecular formula C13H14Cl2N4O and a molecular weight of 313.18 g/mol. IUPAC name: 6,7-dichloro-3-(4-methylpiperazin-1-yl)-1H-quinoxalin-2-one. InChIKey: MFJVHWQDKIEBCM-UHFFFAOYSA-N.
| Molecular formula | C13H14Cl2N4O |
|---|---|
| Molecular weight | 313.18 g/mol |
| IUPAC name | 6,7-dichloro-3-(4-methylpiperazin-1-yl)-1H-quinoxalin-2-one |
| InChIKey | MFJVHWQDKIEBCM-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC3=CC(=C(C=C3NC2=O)Cl)Cl |
Computed by PubChem (NCBI)