CAS 205448-48-2 appears in our catalog under these names: 4-Chloro-3-fluoro-6,7-dimethoxyquinoline, 95%, 4-Chloro-3-fluoro-6,7-dimethoxyquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-chloro-3-fluoro-6,7-dimethoxyquinoline (CAS 205448-48-2) is a chemical compound with the molecular formula C11H9ClFNO2 and a molecular weight of 241.64 g/mol. IUPAC name: 4-chloro-3-fluoro-6,7-dimethoxyquinoline. InChIKey: BNPHXGLBSOUUJE-UHFFFAOYSA-N.
| Molecular formula | C11H9ClFNO2 |
|---|---|
| Molecular weight | 241.64 g/mol |
| IUPAC name | 4-chloro-3-fluoro-6,7-dimethoxyquinoline |
| InChIKey | BNPHXGLBSOUUJE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=C(C=N2)F)Cl)OC |
Computed by PubChem (NCBI)