Products 1204501-37-0
CAS 1204501-37-0 is the registry number for Ethyl 5-chloro-7-fluoro-1H-indole-2-carboxylate, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 5-chloro-7-fluoro-1H-indole-2-carboxylate (CAS 1204501-37-0) is a chemical compound with the molecular formula C11H9ClFNO2 and a molecular weight of 241.64 g/mol. IUPAC name: ethyl 5-chloro-7-fluoro-1H-indole-2-carboxylate. InChIKey: HFBSVXMAYVSVIR-UHFFFAOYSA-N.
| Molecular formula | C11H9ClFNO2 |
|---|---|
| Molecular weight | 241.64 g/mol |
| IUPAC name | ethyl 5-chloro-7-fluoro-1H-indole-2-carboxylate |
| InChIKey | HFBSVXMAYVSVIR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=CC(=CC(=C2N1)F)Cl |
Computed by PubChem (NCBI)