CAS 2055051-56-2 is the registry number for N-(3-(Methoxy-d3)phenyl)acetamide. Offered by: TRC. Available pack sizes: 25mg.
N-[3-(trideuteriomethoxy)phenyl]acetamide (CAS 2055051-56-2) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 168.21 g/mol. IUPAC name: N-[3-(trideuteriomethoxy)phenyl]acetamide. InChIKey: OIEFZHJNURGFFI-BMSJAHLVSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 168.21 g/mol |
| IUPAC name | N-[3-(trideuteriomethoxy)phenyl]acetamide |
| InChIKey | OIEFZHJNURGFFI-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC(=C1)NC(=O)C |
Computed by PubChem (NCBI)