CAS 2055119-28-1 is the registry number for 8-(Trifluoromethyl)quinoline-4-carbonitrile, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
8-(trifluoromethyl)quinoline-4-carbonitrile (CAS 2055119-28-1) is a chemical compound with the molecular formula C11H5F3N2 and a molecular weight of 222.17 g/mol. IUPAC name: 8-(trifluoromethyl)quinoline-4-carbonitrile. InChIKey: GGLAMLCHJQORHZ-UHFFFAOYSA-N.
| Molecular formula | C11H5F3N2 |
|---|---|
| Molecular weight | 222.17 g/mol |
| IUPAC name | 8-(trifluoromethyl)quinoline-4-carbonitrile |
| InChIKey | GGLAMLCHJQORHZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C(=C1)C(F)(F)F)C#N |
Computed by PubChem (NCBI)