CAS 36937-90-3 appears in our catalog under these names: 2-(3-Trifluorobenzylidene)-malononitrile, 95%, 2-(3-TrifluorobenzylidenE)-malononitrile, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-[[3-(trifluoromethyl)phenyl]methylidene]propanedinitrile (CAS 36937-90-3) is a chemical compound with the molecular formula C11H5F3N2 and a molecular weight of 222.17 g/mol. IUPAC name: 2-[[3-(trifluoromethyl)phenyl]methylidene]propanedinitrile. InChIKey: IAGXCFRBKLIQIR-UHFFFAOYSA-N.
| Molecular formula | C11H5F3N2 |
|---|---|
| Molecular weight | 222.17 g/mol |
| IUPAC name | 2-[[3-(trifluoromethyl)phenyl]methylidene]propanedinitrile |
| InChIKey | IAGXCFRBKLIQIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C=C(C#N)C#N |
Computed by PubChem (NCBI)