CAS 20555-67-3 is the registry number for 4-Amino-n-(3,4-dimethylphenyl)benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-amino-N-(3,4-dimethylphenyl)benzenesulfonamide (CAS 20555-67-3) is a chemical compound with the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. IUPAC name: 4-amino-N-(3,4-dimethylphenyl)benzenesulfonamide. InChIKey: DTALSVTYPBXLQL-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O2S |
|---|---|
| Molecular weight | 276.36 g/mol |
| IUPAC name | 4-amino-N-(3,4-dimethylphenyl)benzenesulfonamide |
| InChIKey | DTALSVTYPBXLQL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)N)C |
Computed by PubChem (NCBI)