Products 565195-67-7
CAS 565195-67-7 is the registry number for 5-Amino-2-methyl-n-(3-methylphenyl)benzene-1-sulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-amino-2-methyl-N-(3-methylphenyl)benzenesulfonamide (CAS 565195-67-7) is a chemical compound with the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. IUPAC name: 5-amino-2-methyl-N-(3-methylphenyl)benzenesulfonamide. InChIKey: DOEAOOVSZCAXKG-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O2S |
|---|---|
| Molecular weight | 276.36 g/mol |
| IUPAC name | 5-amino-2-methyl-N-(3-methylphenyl)benzenesulfonamide |
| InChIKey | DOEAOOVSZCAXKG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NS(=O)(=O)C2=C(C=CC(=C2)N)C |
Computed by PubChem (NCBI)