Products 2055742-98-6
CAS 2055742-98-6 appears in our catalog under these names: 2-Hydroxy-3-(trifluoromethyl)phenylboronic acid, pinacol ester, 95%, 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)phenol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 2,5g.
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)phenol (CAS 2055742-98-6) is a chemical compound with the molecular formula C13H16BF3O3 and a molecular weight of 288.07 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)phenol. InChIKey: BWUQMVGZBPQGOY-UHFFFAOYSA-N.
| Molecular formula | C13H16BF3O3 |
|---|---|
| Molecular weight | 288.07 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)phenol |
| InChIKey | BWUQMVGZBPQGOY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)C(F)(F)F)O |
Computed by PubChem (NCBI)