Products 2673219-50-4
CAS 2673219-50-4 is the registry number for 4,4,5,5-Tetramethyl-2-(2,3,5-trifluoro-4-methoxyphenyl)-1,3,2-dioxaborolane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,4,5,5-tetramethyl-2-(2,3,5-trifluoro-4-methoxyphenyl)-1,3,2-dioxaborolane (CAS 2673219-50-4) is a chemical compound with the molecular formula C13H16BF3O3 and a molecular weight of 288.07 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2,3,5-trifluoro-4-methoxyphenyl)-1,3,2-dioxaborolane. InChIKey: IWNVFUVDPQVBGV-UHFFFAOYSA-N.
| Molecular formula | C13H16BF3O3 |
|---|---|
| Molecular weight | 288.07 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2,3,5-trifluoro-4-methoxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | IWNVFUVDPQVBGV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2F)F)OC)F |
Computed by PubChem (NCBI)