Products 2055829-03-1
CAS 2055829-03-1 is the registry number for Nur77 modulator 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[8-(1-adamantyl)-6-hydroxy-4-oxochromen-2-yl]-N-hydroxybenzamide (CAS 2055829-03-1) is a chemical compound with the molecular formula C26H25NO5 and a molecular weight of 431.5 g/mol. IUPAC name: 4-[8-(1-adamantyl)-6-hydroxy-4-oxochromen-2-yl]-N-hydroxybenzamide. InChIKey: VOQHQKKYIRGKSM-UHFFFAOYSA-N.
| Molecular formula | C26H25NO5 |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | 4-[8-(1-adamantyl)-6-hydroxy-4-oxochromen-2-yl]-N-hydroxybenzamide |
| InChIKey | VOQHQKKYIRGKSM-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=CC(=CC5=C4OC(=CC5=O)C6=CC=C(C=C6)C(=O)NO)O |
Computed by PubChem (NCBI)
Synonyms:
Nur77 modulator 2, orb1687638