CAS 2055839-93-3 is the registry number for 2-(3',5'-Difluoro-[1,1'-biphenyl]-2-yl)ethanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[2-(3,5-difluorophenyl)phenyl]ethanamine;hydrochloride (CAS 2055839-93-3) is a chemical compound with the molecular formula C14H14ClF2N and a molecular weight of 269.72 g/mol. IUPAC name: 2-[2-(3,5-difluorophenyl)phenyl]ethanamine;hydrochloride. InChIKey: WIQSLCNWLPEWGW-UHFFFAOYSA-N.
| Molecular formula | C14H14ClF2N |
|---|---|
| Molecular weight | 269.72 g/mol |
| IUPAC name | 2-[2-(3,5-difluorophenyl)phenyl]ethanamine;hydrochloride |
| InChIKey | WIQSLCNWLPEWGW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCN)C2=CC(=CC(=C2)F)F.Cl |
Computed by PubChem (NCBI)