CAS 646051-52-7 appears in our catalog under these names: Bis(4-fluorobenzyl)amine hydrochloride, 97%, Pimavanserin Impurity 15 HCl, Pimavanserin Impurity 1, Bis(4-fluorobenzyl)amine Hydrochloride, Bis(4-fluorobenzyl)amine hydrochloride 97%. Offered by: Combi-blocks, Chemat Brand, Hubei YoungXin, TRC, Ambeed. Available pack sizes: 5g, 1g, 250mg, on request, 10mg, 25mg, 50mg, 100mg.
1-(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]methanamine;hydrochloride (CAS 646051-52-7) is a chemical compound with the molecular formula C14H14ClF2N and a molecular weight of 269.72 g/mol. IUPAC name: 1-(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]methanamine;hydrochloride. InChIKey: NCWBHCCOIATEQZ-UHFFFAOYSA-N.
| Molecular formula | C14H14ClF2N |
|---|---|
| Molecular weight | 269.72 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]methanamine;hydrochloride |
| InChIKey | NCWBHCCOIATEQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNCC2=CC=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)