CAS 2055840-48-5 is the registry number for 7-Methylchroman-4-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
7-methyl-2,3-dihydrochromen-4-one;hydrochloride (CAS 2055840-48-5) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 7-methyl-2,3-dihydrochromen-4-one;hydrochloride. InChIKey: UIBFTCPEXQFUFP-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 7-methyl-2,3-dihydrochromen-4-one;hydrochloride |
| InChIKey | UIBFTCPEXQFUFP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=O)CCO2.Cl |
Computed by PubChem (NCBI)