Products 2055840-79-2

CAS 2055840-79-2 is the registry number for Pyrrolo[3,4-c]pyrazole-5(1h)-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

1H-pyrrolo[3,4-c]pyrazole-5-carboxylic acid (CAS 2055840-79-2) is a chemical compound with the molecular formula C6H5N3O2 and a molecular weight of 151.12 g/mol. IUPAC name: 1H-pyrrolo[3,4-c]pyrazole-5-carboxylic acid. InChIKey: QMINMNRMUSQXBL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5N3O2
Molecular weight151.12 g/mol
IUPAC name1H-pyrrolo[3,4-c]pyrazole-5-carboxylic acid
InChIKeyQMINMNRMUSQXBL-UHFFFAOYSA-N
SMILESC1=C2C=NNC2=CN1C(=O)O

Computed by PubChem (NCBI)